|
|
Summary
longprop
| IUPAC name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthren-17-one | | | | Synonyms | 53-16-7, InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-16,19H,2,4,6-9H2,1H3/t14-,15-,16+,18+/m1/s1, estrone, 3-hydroxyestra-1(10),2,4-trien-17-one, 8r9s13s14s-3-hydroxy-13-methyl-7891112141516-octahydro-6h-cyclopentaaphenanthren-17-one, 8r9s13s14s-3-hydroxy-13-methyl-7891112141516-octahydro-6h-cyclopentaaphenanthren-17-on | | CAS number | 53-16-7 | | ChemSpider ID | 5660 | | PubChem ID | 5870 | | Molecular weight | 270.366 Da | | Formula | C18H22O2 | | Multiplicity | 1 | | Point group | C1 | | Symmetry number | 1 | | Rotatable bonds | NA | | StdInChi | InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-16,19H,2,4,6-9H2,1H3/t14-,15-,16+,18+/m1/s1 |
Liquid properties
| Property | Unit | T (K) | Experiment | GAFF-ESP-2012 | OPLS | CGenFF | COSMO-RS | kowwin | GAFF-ESP | XlogP3 |
|---|
| log kOW | | 298.15 | 2.951 | | | | | | | 3.102 | Flexible models Hydrogen constrained All bonds constrained.
Gas properties
| Property | Unit | T (K) | Experiment | G2 | G3 | G4 | CBS-QB3 | W1BD | W1U | B3LYP/aug-cc-pVTZ | BS | CGenFF | GAFF-BCC-2018 | GAFF-ESP-2018 | AXpp | AXpg | AXps |
|---|
| E | kJ/mol | 298.15 | | | | | | | | | | 978.073 | | | | | | | E-scaled | kJ/mol | 298.15 | | | | | | | | | | 1009.213 | | | | | | | S0 | J/mol K | 298.15 | | | | | | | | | | 542.173 | | | | | | | S0-scaled | J/mol K | 298.15 | | | | | | | | | | 532.853 | | | | | | | ZPE | kJ/mol | 298.15 | | | | | | | | | | 932.83 | | | | | | | ZPE-scaled | kJ/mol | 298.15 | | | | | | | | | | 965.53 | | | | | | | CV | J/mol K | 298.15 | | | | | | | | | | 301.13 | | | | | | | CV-scaled | J/mol K | 298.15 | | | | | | | | | | 290.63 | | | | | | | αaniso | ų | 298.15 | | | | | | | | | | | | | 12.924 | 13.014 | 12.924 |
References
- Stephen G. Machatha and Samuel H. Yalkowsky Comparison of the octanol/water partition coefficients calculated by ClogP, ACDlogP and KowWin to experimentally determined values, Int. J. Pharmaceut. 294, 185-192 (2005).
- T. Cheng and Y. Zhao and X. Li and F. Lin and Y. Xu and X. Zhang and Y. Li and R. Wang and L. Lai Computation of octanol- water partition coefficients by guiding an additive model with knowledge., J. Chem. Inf. Model. 47, 2140-2148 (2007).
- David van der Spoel and Mohammad M. Ghahremanpour and Justin Lemkul Small Molecule Thermochemistry: A Tool For Empirical Force Field Development, J. Phys. Chem. A 122, 8982–8988 (2018). DOI
- Mohammad Mehdi Ghahremanpour and Paul J. van Maaren and Carl Caleman and Geoffrey R. Hutchison and David van der Spoel Polarizable Drude Model with s-type Gaussian or Slater Charge Density for General Molecular Mechanics Force Fields, J. Chem. Theory Comput. 14, 5553-5566 (2018). DOI
|